C23H21NO — CID 11896515
(2S,3S,3aS,9bR)-2,3-diphenyl-1,2,3,3a,4,9b-hexahydrochromeno[4,3-b]pyrrole (PubChem CID 11896515) has the molecular formula C23H21NO and a molecular weight of 327.43 g/mol. Its IUPAC name is (2S,3S,3aS,9bR)-2,3-diphenyl-1,2,3,3a,4,9b-hexahydrochromeno[4,3-b]pyrrole.
| Compound Name | (2S,3S,3aS,9bR)-2,3-diphenyl-1,2,3,3a,4,9b-hexahydrochromeno[4,3-b]pyrrole |
|---|---|
| PubChem CID | 11896515 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (2S,3S,3aS,9bR)-2,3-diphenyl-1,2,3,3a,4,9b-hexahydrochromeno[4,3-b]pyrrole |
| SMILES | c1ccc([C@@H]2[C@@H]3COc4ccccc4[C@@H]3N[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO/c1-3-9-16(10-4-1)21-19-15-25-20-14-8-7-13-18(20)23(19)24-22(21)17-11-5-2-6-12-17/h1-14,19,21-24H,15H2/t19-,21+,22+,23-/m0/s1 |
| InChIKey | RCYAVNHQXWBEAI-IZBOUPIGSA-N |
| XLogP | 4.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |