C18H18N2O2S — CID 137264965
N-(3,3-dimethyl-1,2-dihydroinden-1-yl)-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 137264965) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-(3,3-dimethyl-1,2-dihydroinden-1-yl)-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-(3,3-dimethyl-1,2-dihydroinden-1-yl)-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 137264965 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-(3,3-dimethyl-1,2-dihydroinden-1-yl)-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | CC1(C)CC(/N=C2\NS(=O)(=O)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C18H18N2O2S/c1-18(2)11-15(12-7-3-5-9-14(12)18)19-17-13-8-4-6-10-16(13)23(21,22)20-17/h3-10,15H,11H2,1-2H3,(H,19,20) |
| InChIKey | XVSSIQXWSXUMPK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|