C18H24N2O3S — CID 137263025
N-(3-ethoxyspiro[3.5]nonan-1-yl)-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 137263025) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-(3-ethoxyspiro[3.5]nonan-1-yl)-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-(3-ethoxyspiro[3.5]nonan-1-yl)-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 137263025 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(3-ethoxyspiro[3.5]nonan-1-yl)-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | CCOC1CC(/N=C2\NS(=O)(=O)c3ccccc32)C12CCCCC2 |
| InChI | InChI=1S/C18H24N2O3S/c1-2-23-16-12-15(18(16)10-6-3-7-11-18)19-17-13-8-4-5-9-14(13)24(21,22)20-17/h4-5,8-9,15-16H,2-3,6-7,10-12H2,1H3,(H,19,20) |
| InChIKey | KUDCYGWEYRNLDV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|