C13H14N2O3S — CID 137264784
N-[(2S)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 137264784) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is N-[(2S)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-[(2S)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 137264784 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-[(2S)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | O=S1(=O)N/C(=N\[C@H]2CC3CCC2O3)c2ccccc21 |
| InChI | InChI=1S/C13H14N2O3S/c16-19(17)12-4-2-1-3-9(12)13(15-19)14-10-7-8-5-6-11(10)18-8/h1-4,8,10-11H,5-7H2,(H,14,15)/t8?,10-,11?/m0/s1 |
| InChIKey | KPXGPMSFUACJGY-JZQLECPJSA-N |
| XLogP | 1.04 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|