C16H16N4O4S — CID 137225703
2-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]oxolan-3-yl]-6-methylpyridazin-3-one (PubChem CID 137225703) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is 2-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]oxolan-3-yl]-6-methylpyridazin-3-one.
| Compound Name | 2-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]oxolan-3-yl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 137225703 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]oxolan-3-yl]-6-methylpyridazin-3-one |
| SMILES | Cc1ccc(=O)n(C2COCC2/N=C2\NS(=O)(=O)c3ccccc32)n1 |
| InChI | InChI=1S/C16H16N4O4S/c1-10-6-7-15(21)20(18-10)13-9-24-8-12(13)17-16-11-4-2-3-5-14(11)25(22,23)19-16/h2-7,12-13H,8-9H2,1H3,(H,17,19) |
| InChIKey | XWXUBOCGJLWDNN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|