C18H21N5O3S — CID 137193658
6-[2-[[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]methyl]piperidin-1-yl]-2-methylpyridazin-3-one (PubChem CID 137193658) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is 6-[2-[[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]methyl]piperidin-1-yl]-2-methylpyridazin-3-one.
| Compound Name | 6-[2-[[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]methyl]piperidin-1-yl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 137193658 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 6-[2-[[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]methyl]piperidin-1-yl]-2-methylpyridazin-3-one |
| SMILES | Cn1nc(N2CCCCC2C/N=C2\NS(=O)(=O)c3ccccc32)ccc1=O |
| InChI | InChI=1S/C18H21N5O3S/c1-22-17(24)10-9-16(20-22)23-11-5-4-6-13(23)12-19-18-14-7-2-3-8-15(14)27(25,26)21-18/h2-3,7-10,13H,4-6,11-12H2,1H3,(H,19,21) |
| InChIKey | LQRFSNBUIWAZMS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|