C17H18N4O3S — CID 137193674
2-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]cyclohexyl]pyridazin-3-one (PubChem CID 137193674) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]cyclohexyl]pyridazin-3-one.
| Compound Name | 2-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]cyclohexyl]pyridazin-3-one |
|---|---|
| PubChem CID | 137193674 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]cyclohexyl]pyridazin-3-one |
| SMILES | O=c1cccnn1C1CCC(/N=C2\NS(=O)(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C17H18N4O3S/c22-16-6-3-11-18-21(16)13-9-7-12(8-10-13)19-17-14-4-1-2-5-15(14)25(23,24)20-17/h1-6,11-13H,7-10H2,(H,19,20) |
| InChIKey | MOPABKKAIQKLRB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|