C12H14N2O2S2 — CID 136872422
N-[(1-methylsulfanylcyclopropyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 136872422) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is N-[(1-methylsulfanylcyclopropyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-[(1-methylsulfanylcyclopropyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 136872422 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N-[(1-methylsulfanylcyclopropyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | CSC1(C/N=C2\NS(=O)(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C12H14N2O2S2/c1-17-12(6-7-12)8-13-11-9-4-2-3-5-10(9)18(15,16)14-11/h2-5H,6-8H2,1H3,(H,13,14) |
| InChIKey | NAVURYJXGCQEJE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|