C13H14N4O2S — CID 136924671
N-[2-(1-methylpyrazol-4-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 136924671) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is N-[2-(1-methylpyrazol-4-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-[2-(1-methylpyrazol-4-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 136924671 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-[2-(1-methylpyrazol-4-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | Cn1cc(CC/N=C2\NS(=O)(=O)c3ccccc32)cn1 |
| InChI | InChI=1S/C13H14N4O2S/c1-17-9-10(8-15-17)6-7-14-13-11-4-2-3-5-12(11)20(18,19)16-13/h2-5,8-9H,6-7H2,1H3,(H,14,16) |
| InChIKey | ARBXFOIYLLRNSX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|