C14H16N2O2S — CID 136713678
N-[2-(cyclopenten-1-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 136713678) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-[2-(cyclopenten-1-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-[2-(cyclopenten-1-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 136713678 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-[2-(cyclopenten-1-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | O=S1(=O)N/C(=N\CCC2=CCCC2)c2ccccc21 |
| InChI | InChI=1S/C14H16N2O2S/c17-19(18)13-8-4-3-7-12(13)14(16-19)15-10-9-11-5-1-2-6-11/h3-5,7-8H,1-2,6,9-10H2,(H,15,16) |
| InChIKey | CYTYXEWZWWYHGV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|