C18H21BrN2O2S — CID 135810014
5-(3-bromophenyl)-N-[2-(cyclohexen-1-yl)ethyl]-4-methyl-1,1-dioxo-1,2-thiazol-3-imine (PubChem CID 135810014) has the molecular formula C18H21BrN2O2S and a molecular weight of 409.35 g/mol. Its IUPAC name is 5-(3-bromophenyl)-N-[2-(cyclohexen-1-yl)ethyl]-4-methyl-1,1-dioxo-1,2-thiazol-3-imine.
| Compound Name | 5-(3-bromophenyl)-N-[2-(cyclohexen-1-yl)ethyl]-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 135810014 |
| Molecular Formula | C18H21BrN2O2S |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 5-(3-bromophenyl)-N-[2-(cyclohexen-1-yl)ethyl]-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
| SMILES | CC1=C(c2cccc(Br)c2)S(=O)(=O)N/C1=N\CCC1=CCCCC1 |
| InChI | InChI=1S/C18H21BrN2O2S/c1-13-17(15-8-5-9-16(19)12-15)24(22,23)21-18(13)20-11-10-14-6-3-2-4-7-14/h5-6,8-9,12H,2-4,7,10-11H2,1H3,(H,20,21) |
| InChIKey | NXUBWOLLRUJKAB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|