C17H21BrN2O2 — CID 46652282
3-bromo-N-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]benzamide (PubChem CID 46652282) has the molecular formula C17H21BrN2O2 and a molecular weight of 365.27 g/mol. Its IUPAC name is 3-bromo-N-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 46652282 |
| Molecular Formula | C17H21BrN2O2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 3-bromo-N-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Br)c1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H21BrN2O2/c18-15-8-4-7-14(11-15)17(22)20-12-16(21)19-10-9-13-5-2-1-3-6-13/h4-5,7-8,11H,1-3,6,9-10,12H2,(H,19,21)(H,20,22) |
| InChIKey | MGYVRKGOVNSYAL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|