C13H17N3O2S — CID 136879285
1,1-dioxo-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1,2-benzothiazol-3-imine (PubChem CID 136879285) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 1,1-dioxo-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1,2-benzothiazol-3-imine.
| Compound Name | 1,1-dioxo-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 136879285 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1,1-dioxo-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1,2-benzothiazol-3-imine |
| SMILES | O=S1(=O)N/C(=N\CC[C@H]2CCCN2)c2ccccc21 |
| InChI | InChI=1S/C13H17N3O2S/c17-19(18)12-6-2-1-5-11(12)13(16-19)15-9-7-10-4-3-8-14-10/h1-2,5-6,10,14H,3-4,7-9H2,(H,15,16)/t10-/m1/s1 |
| InChIKey | URDPNGBURQLPNW-SNVBAGLBSA-N |
| XLogP | 0.87 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|