C24H20N2O2S — CID 135897522
1,1-dioxo-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]-1,2-benzothiazol-3-imine (PubChem CID 135897522) has the molecular formula C24H20N2O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is 1,1-dioxo-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]-1,2-benzothiazol-3-imine.
| Compound Name | 1,1-dioxo-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 135897522 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1,1-dioxo-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]-1,2-benzothiazol-3-imine |
| SMILES | O=S1(=O)N/C(=N\C[C@H]2CC3c4ccccc4C2c2ccccc23)c2ccccc21 |
| InChI | InChI=1S/C24H20N2O2S/c27-29(28)22-12-6-5-11-20(22)24(26-29)25-14-15-13-21-16-7-1-3-9-18(16)23(15)19-10-4-2-8-17(19)21/h1-12,15,21,23H,13-14H2,(H,25,26)/t15-,21?,23?/m1/s1 |
| InChIKey | PPQQEDJXMICYFO-UWFASSMRSA-N |
| XLogP | 4.02 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|