C22H22N4O4S — CID 154833821
3-[1-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]piperidin-4-yl]-1,3-dihydroindol-2-one (PubChem CID 154833821) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is 3-[1-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]piperidin-4-yl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[1-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]piperidin-4-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 154833821 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 3-[1-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]piperidin-4-yl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccccc2C1C1CCN(C(=O)C/N=C2\NS(=O)(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C22H22N4O4S/c27-19(13-23-21-16-6-2-4-8-18(16)31(29,30)25-21)26-11-9-14(10-12-26)20-15-5-1-3-7-17(15)24-22(20)28/h1-8,14,20H,9-13H2,(H,23,25)(H,24,28) |
| InChIKey | UQGMWVMIFRBBLO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|