C17H24N4O3S — CID 137152254
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-[2-(methylamino)ethyl]piperidin-1-yl]ethanone (PubChem CID 137152254) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-[2-(methylamino)ethyl]piperidin-1-yl]ethanone.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-[2-(methylamino)ethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 137152254 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-[2-(methylamino)ethyl]piperidin-1-yl]ethanone |
| SMILES | CNCCC1CCN(C(=O)C/N=C2\NS(=O)(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C17H24N4O3S/c1-18-9-6-13-7-10-21(11-8-13)16(22)12-19-17-14-4-2-3-5-15(14)25(23,24)20-17/h2-5,13,18H,6-12H2,1H3,(H,19,20) |
| InChIKey | MRZUJJOLPRBLBM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|