C14H17N3O4S — CID 135922650
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[(2S)-2-methylmorpholin-4-yl]ethanone (PubChem CID 135922650) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[(2S)-2-methylmorpholin-4-yl]ethanone.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[(2S)-2-methylmorpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 135922650 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[(2S)-2-methylmorpholin-4-yl]ethanone |
| SMILES | C[C@H]1CN(C(=O)C/N=C2\NS(=O)(=O)c3ccccc32)CCO1 |
| InChI | InChI=1S/C14H17N3O4S/c1-10-9-17(6-7-21-10)13(18)8-15-14-11-4-2-3-5-12(11)22(19,20)16-14/h2-5,10H,6-9H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | LBJSHOZSSCQIOP-JTQLQIEISA-N |
| XLogP | -0.03 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|