C23H22N4O5S2 — CID 135728955
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone (PubChem CID 135728955) has the molecular formula C23H22N4O5S2 and a molecular weight of 498.59 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 135728955 |
| Molecular Formula | C23H22N4O5S2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone |
| SMILES | O=C(C/N=C1\NS(=O)(=O)c2ccccc21)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C23H22N4O5S2/c28-22(16-24-23-20-7-3-4-8-21(20)33(29,30)25-23)26-11-13-27(14-12-26)34(31,32)19-10-9-17-5-1-2-6-18(17)15-19/h1-10,15H,11-14,16H2,(H,24,25) |
| InChIKey | MTTLOJJUOGPVKO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|