C22H24N4O5S2 — CID 135623896
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 135623896) has the molecular formula C22H24N4O5S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 135623896 |
| Molecular Formula | C22H24N4O5S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | O=C(CC/N=C1\NS(=O)(=O)c2ccccc21)N1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C22H24N4O5S2/c27-21(10-12-23-22-19-8-4-5-9-20(19)33(30,31)24-22)25-13-15-26(16-14-25)32(28,29)17-11-18-6-2-1-3-7-18/h1-9,11,17H,10,12-16H2,(H,23,24)/b17-11+ |
| InChIKey | FFZAQVVVLYRFKC-GZTJUZNOSA-N |
| XLogP | 1.26 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|