C14H18N4O3S — CID 137098179
1-(1,4-diazepan-1-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethanone (PubChem CID 137098179) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethanone.
| Compound Name | 1-(1,4-diazepan-1-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethanone |
|---|---|
| PubChem CID | 137098179 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethanone |
| SMILES | O=C(C/N=C1\NS(=O)(=O)c2ccccc21)N1CCCNCC1 |
| InChI | InChI=1S/C14H18N4O3S/c19-13(18-8-3-6-15-7-9-18)10-16-14-11-4-1-2-5-12(11)22(20,21)17-14/h1-2,4-5,15H,3,6-10H2,(H,16,17) |
| InChIKey | BNQNGCHATHSLIU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|