C18H27ClN4O3S — CID 137122457
6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(3-methylpiperazin-1-yl)hexan-1-one;hydrochloride (PubChem CID 137122457) has the molecular formula C18H27ClN4O3S and a molecular weight of 414.96 g/mol. Its IUPAC name is 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(3-methylpiperazin-1-yl)hexan-1-one;hydrochloride.
| Compound Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(3-methylpiperazin-1-yl)hexan-1-one;hydrochloride |
|---|---|
| PubChem CID | 137122457 |
| Molecular Formula | C18H27ClN4O3S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(3-methylpiperazin-1-yl)hexan-1-one;hydrochloride |
| SMILES | CC1CN(C(=O)CCCCC/N=C2\NS(=O)(=O)c3ccccc32)CCN1.Cl |
| InChI | InChI=1S/C18H26N4O3S.ClH/c1-14-13-22(12-11-19-14)17(23)9-3-2-6-10-20-18-15-7-4-5-8-16(15)26(24,25)21-18;/h4-5,7-8,14,19H,2-3,6,9-13H2,1H3,(H,20,21);1H |
| InChIKey | SKCDSPSTBGZNGG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|