C17H25ClN4O3S — CID 137104617
1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butan-1-one;hydrochloride (PubChem CID 137104617) has the molecular formula C17H25ClN4O3S and a molecular weight of 400.93 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butan-1-one;hydrochloride.
| Compound Name | 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 137104617 |
| Molecular Formula | C17H25ClN4O3S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butan-1-one;hydrochloride |
| SMILES | CC1(CN)CCN(C(=O)CCC/N=C2\NS(=O)(=O)c3ccccc32)C1.Cl |
| InChI | InChI=1S/C17H24N4O3S.ClH/c1-17(11-18)8-10-21(12-17)15(22)7-4-9-19-16-13-5-2-3-6-14(13)25(23,24)20-16;/h2-3,5-6H,4,7-12,18H2,1H3,(H,19,20);1H |
| InChIKey | XRJJRNKMSCBZNW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|