C20H22N4O5S2 — CID 154772916
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(3-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 154772916) has the molecular formula C20H22N4O5S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(3-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(3-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 154772916 |
| Molecular Formula | C20H22N4O5S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(3-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CC/N=C1\NS(=O)(=O)c2ccccc21)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H22N4O5S2/c25-19(10-11-21-20-17-8-1-2-9-18(17)30(26,27)23-20)22-15-6-5-7-16(14-15)31(28,29)24-12-3-4-13-24/h1-2,5-9,14H,3-4,10-13H2,(H,21,23)(H,22,25) |
| InChIKey | YCBHMLOPTLBMQV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|