C22H26N4O5S2 — CID 135799423
(2S)-N-[3-(azepan-1-ylsulfonyl)phenyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide (PubChem CID 135799423) has the molecular formula C22H26N4O5S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is (2S)-N-[3-(azepan-1-ylsulfonyl)phenyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide.
| Compound Name | (2S)-N-[3-(azepan-1-ylsulfonyl)phenyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide |
|---|---|
| PubChem CID | 135799423 |
| Molecular Formula | C22H26N4O5S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | (2S)-N-[3-(azepan-1-ylsulfonyl)phenyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide |
| SMILES | C[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C22H26N4O5S2/c1-16(23-21-19-11-4-5-12-20(19)32(28,29)25-21)22(27)24-17-9-8-10-18(15-17)33(30,31)26-13-6-2-3-7-14-26/h4-5,8-12,15-16H,2-3,6-7,13-14H2,1H3,(H,23,25)(H,24,27)/t16-/m0/s1 |
| InChIKey | IVHYNSJROCIZJR-INIZCTEOSA-N |
| XLogP | 2.32 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|