C14H16N2O3S — CID 137273684
N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 137273684) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 137273684 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | O=S1(=O)N/C(=N\CCC2=CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C14H16N2O3S/c17-20(18)13-4-2-1-3-12(13)14(16-20)15-8-5-11-6-9-19-10-7-11/h1-4,6H,5,7-10H2,(H,15,16) |
| InChIKey | FKVZWAOVWCVNGO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|