C17H21N5O3S — CID 135857702
6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(1-methylpyrazol-3-yl)hexanamide (PubChem CID 135857702) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(1-methylpyrazol-3-yl)hexanamide.
| Compound Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(1-methylpyrazol-3-yl)hexanamide |
|---|---|
| PubChem CID | 135857702 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(1-methylpyrazol-3-yl)hexanamide |
| SMILES | Cn1ccc(NC(=O)CCCCC/N=C2\NS(=O)(=O)c3ccccc32)n1 |
| InChI | InChI=1S/C17H21N5O3S/c1-22-12-10-15(20-22)19-16(23)9-3-2-6-11-18-17-13-7-4-5-8-14(13)26(24,25)21-17/h4-5,7-8,10,12H,2-3,6,9,11H2,1H3,(H,18,21)(H,19,20,23) |
| InChIKey | KEZKVAHNYXDPIR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|