C14H15N5O3S — CID 137274734
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(1-methylpyrazol-3-yl)propanamide (PubChem CID 137274734) has the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(1-methylpyrazol-3-yl)propanamide.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(1-methylpyrazol-3-yl)propanamide |
|---|---|
| PubChem CID | 137274734 |
| Molecular Formula | C14H15N5O3S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(1-methylpyrazol-3-yl)propanamide |
| SMILES | Cn1ccc(NC(=O)CC/N=C2\NS(=O)(=O)c3ccccc32)n1 |
| InChI | InChI=1S/C14H15N5O3S/c1-19-9-7-12(17-19)16-13(20)6-8-15-14-10-4-2-3-5-11(10)23(21,22)18-14/h2-5,7,9H,6,8H2,1H3,(H,15,18)(H,16,17,20) |
| InChIKey | YFDZSUXIQIIACR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|