C12H15BrN2O2S — CID 136755489
N-(4-bromopentan-2-yl)-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 136755489) has the molecular formula C12H15BrN2O2S and a molecular weight of 331.24 g/mol. Its IUPAC name is N-(4-bromopentan-2-yl)-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-(4-bromopentan-2-yl)-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 136755489 |
| Molecular Formula | C12H15BrN2O2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | N-(4-bromopentan-2-yl)-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | CC(Br)CC(C)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C12H15BrN2O2S/c1-8(13)7-9(2)14-12-10-5-3-4-6-11(10)18(16,17)15-12/h3-6,8-9H,7H2,1-2H3,(H,14,15) |
| InChIKey | CVAPSJMLNPUQOD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|