C13H17ClN2O2S — CID 136993455
N-(1-chloro-4-methylpentan-3-yl)-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 136993455) has the molecular formula C13H17ClN2O2S and a molecular weight of 300.81 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-3-yl)-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-(1-chloro-4-methylpentan-3-yl)-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 136993455 |
| Molecular Formula | C13H17ClN2O2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-(1-chloro-4-methylpentan-3-yl)-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | CC(C)C(CCCl)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H17ClN2O2S/c1-9(2)11(7-8-14)15-13-10-5-3-4-6-12(10)19(17,18)16-13/h3-6,9,11H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | NJWFIKMNWOJWHK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|