C21H18N2O2S — CID 135925710
1,1-dioxo-N-[(1R)-1-(4-phenylphenyl)ethyl]-1,2-benzothiazol-3-imine (PubChem CID 135925710) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is 1,1-dioxo-N-[(1R)-1-(4-phenylphenyl)ethyl]-1,2-benzothiazol-3-imine.
| Compound Name | 1,1-dioxo-N-[(1R)-1-(4-phenylphenyl)ethyl]-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 135925710 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 1,1-dioxo-N-[(1R)-1-(4-phenylphenyl)ethyl]-1,2-benzothiazol-3-imine |
| SMILES | C[C@@H](/N=C1\NS(=O)(=O)c2ccccc21)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18N2O2S/c1-15(16-11-13-18(14-12-16)17-7-3-2-4-8-17)22-21-19-9-5-6-10-20(19)26(24,25)23-21/h2-15H,1H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | DADZKYCABDIXMW-OAHLLOKOSA-N |
| XLogP | 4.15 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|