C14H18N2O2S — CID 137262111
N-hept-6-en-2-yl-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 137262111) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is N-hept-6-en-2-yl-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-hept-6-en-2-yl-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 137262111 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-hept-6-en-2-yl-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | C=CCCCC(C)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C14H18N2O2S/c1-3-4-5-8-11(2)15-14-12-9-6-7-10-13(12)19(17,18)16-14/h3,6-7,9-11H,1,4-5,8H2,2H3,(H,15,16) |
| InChIKey | DZGNULNSXMNGFR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|