C17H23N3O5S — CID 137010233
4-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoylamino]-4-methylpentanoic acid (PubChem CID 137010233) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 4-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 137010233 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoylamino]-4-methylpentanoic acid |
| SMILES | CC(CC(=O)NC(C)(C)CCC(=O)O)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H23N3O5S/c1-11(10-14(21)19-17(2,3)9-8-15(22)23)18-16-12-6-4-5-7-13(12)26(24,25)20-16/h4-7,11H,8-10H2,1-3H3,(H,18,20)(H,19,21)(H,22,23) |
| InChIKey | DMUDVEUMBWNAFH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|