C14H15N3O4S2 — CID 135736574
cyanomethyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanoate (PubChem CID 135736574) has the molecular formula C14H15N3O4S2 and a molecular weight of 353.43 g/mol. Its IUPAC name is cyanomethyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanoate.
| Compound Name | cyanomethyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 135736574 |
| Molecular Formula | C14H15N3O4S2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | cyanomethyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCC#N |
| InChI | InChI=1S/C14H15N3O4S2/c1-22-9-6-11(14(18)21-8-7-15)16-13-10-4-2-3-5-12(10)23(19,20)17-13/h2-5,11H,6,8-9H2,1H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | FLDIQMHJCAPNMD-NSHDSACASA-N |
| XLogP | 0.91 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|