C25H25N3O4S2 — CID 135728933
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[4-(3-methylphenoxy)phenyl]-4-methylsulfanylbutanamide (PubChem CID 135728933) has the molecular formula C25H25N3O4S2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[4-(3-methylphenoxy)phenyl]-4-methylsulfanylbutanamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[4-(3-methylphenoxy)phenyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 135728933 |
| Molecular Formula | C25H25N3O4S2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[4-(3-methylphenoxy)phenyl]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1ccc(Oc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C25H25N3O4S2/c1-17-6-5-7-20(16-17)32-19-12-10-18(11-13-19)26-25(29)22(14-15-33-2)27-24-21-8-3-4-9-23(21)34(30,31)28-24/h3-13,16,22H,14-15H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | RLAQYENFLJMROT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|