C19H20ClN3O3S2 — CID 136699002
(2R)-N-[(3-chlorophenyl)methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanamide (PubChem CID 136699002) has the molecular formula C19H20ClN3O3S2 and a molecular weight of 437.97 g/mol. Its IUPAC name is (2R)-N-[(3-chlorophenyl)methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-N-[(3-chlorophenyl)methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 136699002 |
| Molecular Formula | C19H20ClN3O3S2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | (2R)-N-[(3-chlorophenyl)methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20ClN3O3S2/c1-27-10-9-16(19(24)21-12-13-5-4-6-14(20)11-13)22-18-15-7-2-3-8-17(15)28(25,26)23-18/h2-8,11,16H,9-10,12H2,1H3,(H,21,24)(H,22,23)/t16-/m1/s1 |
| InChIKey | PYULQVLFRZQPJD-MRXNPFEDSA-N |
| XLogP | 2.82 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|