C25H32N4O4S — CID 135883160
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]hexanamide (PubChem CID 135883160) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]hexanamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 135883160 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]hexanamide |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NCc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C25H32N4O4S/c1-2-3-7-22(27-24-21-6-4-5-8-23(21)34(31,32)28-24)25(30)26-17-19-9-11-20(12-10-19)18-29-13-15-33-16-14-29/h4-6,8-12,22H,2-3,7,13-18H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | JNUQKLDOJOMDSC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|