C23H35N5O4S — CID 135893970
N-tert-butyl-2-[4-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoyl]piperazin-1-yl]acetamide (PubChem CID 135893970) has the molecular formula C23H35N5O4S and a molecular weight of 477.63 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoyl]piperazin-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 135893970 |
| Molecular Formula | C23H35N5O4S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N-tert-butyl-2-[4-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoyl]piperazin-1-yl]acetamide |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCN(CC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H35N5O4S/c1-5-6-10-18(24-21-17-9-7-8-11-19(17)33(31,32)26-21)22(30)28-14-12-27(13-15-28)16-20(29)25-23(2,3)4/h7-9,11,18H,5-6,10,12-16H2,1-4H3,(H,24,26)(H,25,29) |
| InChIKey | ZMBNSEYHIPONFR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|