C22H26N6O5S — CID 135975866
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]hexan-1-one (PubChem CID 135975866) has the molecular formula C22H26N6O5S and a molecular weight of 486.55 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]hexan-1-one.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 135975866 |
| Molecular Formula | C22H26N6O5S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]hexan-1-one |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCN(c2ccc([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C22H26N6O5S/c1-2-3-7-18(24-21-17-6-4-5-8-19(17)34(32,33)25-21)22(29)27-13-11-26(12-14-27)20-10-9-16(15-23-20)28(30)31/h4-6,8-10,15,18H,2-3,7,11-14H2,1H3,(H,24,25) |
| InChIKey | VXVKCLDAKWDDRQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 138.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|