C24H27FN4O4S — CID 135954882
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(3-fluorobenzoyl)piperazin-1-yl]hexan-1-one (PubChem CID 135954882) has the molecular formula C24H27FN4O4S and a molecular weight of 486.57 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(3-fluorobenzoyl)piperazin-1-yl]hexan-1-one.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(3-fluorobenzoyl)piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 135954882 |
| Molecular Formula | C24H27FN4O4S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(3-fluorobenzoyl)piperazin-1-yl]hexan-1-one |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCN(C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C24H27FN4O4S/c1-2-3-10-20(26-22-19-9-4-5-11-21(19)34(32,33)27-22)24(31)29-14-12-28(13-15-29)23(30)17-7-6-8-18(25)16-17/h4-9,11,16,20H,2-3,10,12-15H2,1H3,(H,26,27) |
| InChIKey | QRHAUPIGNSXXNB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|