C20H21N5O6S — CID 135815843
N'-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoyl]-3-nitrobenzohydrazide (PubChem CID 135815843) has the molecular formula C20H21N5O6S and a molecular weight of 459.48 g/mol. Its IUPAC name is N'-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 135815843 |
| Molecular Formula | C20H21N5O6S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | N'-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoyl]-3-nitrobenzohydrazide |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21N5O6S/c1-2-3-10-16(21-18-15-9-4-5-11-17(15)32(30,31)24-18)20(27)23-22-19(26)13-7-6-8-14(12-13)25(28)29/h4-9,11-12,16H,2-3,10H2,1H3,(H,21,24)(H,22,26)(H,23,27) |
| InChIKey | VPWLMGXOQWOIFB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 159.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|