C23H29N5O3S — CID 135957806
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(pyridin-2-ylmethyl)piperazin-1-yl]hexan-1-one (PubChem CID 135957806) has the molecular formula C23H29N5O3S and a molecular weight of 455.58 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(pyridin-2-ylmethyl)piperazin-1-yl]hexan-1-one.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(pyridin-2-ylmethyl)piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 135957806 |
| Molecular Formula | C23H29N5O3S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(pyridin-2-ylmethyl)piperazin-1-yl]hexan-1-one |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C23H29N5O3S/c1-2-3-10-20(25-22-19-9-4-5-11-21(19)32(30,31)26-22)23(29)28-15-13-27(14-16-28)17-18-8-6-7-12-24-18/h4-9,11-12,20H,2-3,10,13-17H2,1H3,(H,25,26) |
| InChIKey | ORDNJEAHTIVRGV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|