C20H22ClN3O3S — CID 135857752
(2S)-N-[(3-chlorophenyl)methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N,3-dimethylbutanamide (PubChem CID 135857752) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is (2S)-N-[(3-chlorophenyl)methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N,3-dimethylbutanamide.
| Compound Name | (2S)-N-[(3-chlorophenyl)methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 135857752 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (2S)-N-[(3-chlorophenyl)methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N,3-dimethylbutanamide |
| SMILES | CC(C)[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O3S/c1-13(2)18(20(25)24(3)12-14-7-6-8-15(21)11-14)22-19-16-9-4-5-10-17(16)28(26,27)23-19/h4-11,13,18H,12H2,1-3H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | JIQMSTDKOCOBKN-SFHVURJKSA-N |
| XLogP | 3.06 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|