C17H16ClN3O3S — CID 135749974
(2S)-N-[(3-chlorophenyl)methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide (PubChem CID 135749974) has the molecular formula C17H16ClN3O3S and a molecular weight of 377.85 g/mol. Its IUPAC name is (2S)-N-[(3-chlorophenyl)methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide.
| Compound Name | (2S)-N-[(3-chlorophenyl)methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide |
|---|---|
| PubChem CID | 135749974 |
| Molecular Formula | C17H16ClN3O3S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | (2S)-N-[(3-chlorophenyl)methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide |
| SMILES | C[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16ClN3O3S/c1-11(17(22)19-10-12-5-4-6-13(18)9-12)20-16-14-7-2-3-8-15(14)25(23,24)21-16/h2-9,11H,10H2,1H3,(H,19,22)(H,20,21)/t11-/m0/s1 |
| InChIKey | ZFDLCKAPGZZROK-NSHDSACASA-N |
| XLogP | 2.08 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|