C13H18N4O3S — CID 137024784
N-[(2S)-1-aminopropan-2-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide (PubChem CID 137024784) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide |
|---|---|
| PubChem CID | 137024784 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N[C@@H](C)CN |
| InChI | InChI=1S/C13H18N4O3S/c1-8(7-14)15-13(18)9(2)16-12-10-5-3-4-6-11(10)21(19,20)17-12/h3-6,8-9H,7,14H2,1-2H3,(H,15,18)(H,16,17)/t8-,9?/m0/s1 |
| InChIKey | HQOIFCPYANBAGJ-IENPIDJESA-N |
| XLogP | -0.42 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|