C16H15N5O4S — CID 136827036
N'-[(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]pyridine-2-carbohydrazide (PubChem CID 136827036) has the molecular formula C16H15N5O4S and a molecular weight of 373.39 g/mol. Its IUPAC name is N'-[(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]pyridine-2-carbohydrazide.
| Compound Name | N'-[(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 136827036 |
| Molecular Formula | C16H15N5O4S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N'-[(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]pyridine-2-carbohydrazide |
| SMILES | C[C@@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NNC(=O)c1ccccn1 |
| InChI | InChI=1S/C16H15N5O4S/c1-10(15(22)19-20-16(23)12-7-4-5-9-17-12)18-14-11-6-2-3-8-13(11)26(24,25)21-14/h2-10H,1H3,(H,18,21)(H,19,22)(H,20,23)/t10-/m1/s1 |
| InChIKey | SVGIKCOJQWGRGK-SNVBAGLBSA-N |
| XLogP | -0.03 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|