C19H21N3O3S2 — CID 136793239
(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(4-methylphenyl)-4-methylsulfanylbutanamide (PubChem CID 136793239) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(4-methylphenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(4-methylphenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 136793239 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(4-methylphenyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C19H21N3O3S2/c1-13-7-9-14(10-8-13)20-19(23)16(11-12-26-2)21-18-15-5-3-4-6-17(15)27(24,25)22-18/h3-10,16H,11-12H2,1-2H3,(H,20,23)(H,21,22)/t16-/m1/s1 |
| InChIKey | PNFRBBGYACHMSH-MRXNPFEDSA-N |
| XLogP | 2.79 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|