C12H13N2O4S2- — CID 135794826
(2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanoate (PubChem CID 135794826) has the molecular formula C12H13N2O4S2- and a molecular weight of 313.38 g/mol. Its IUPAC name is (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 135794826 |
| Molecular Formula | C12H13N2O4S2- |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)[O-] |
| InChI | InChI=1S/C12H14N2O4S2/c1-19-7-6-9(12(15)16)13-11-8-4-2-3-5-10(8)20(17,18)14-11/h2-5,9H,6-7H2,1H3,(H,13,14)(H,15,16)/p-1/t9-/m0/s1 |
| InChIKey | AERAMFZBFSAFDP-VIFPVBQESA-M |
| XLogP | -0.40 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|