C22H21NO3 — CID 3937440
2-(3-methylphenoxy)-N-(4-phenoxyphenyl)propanamide (PubChem CID 3937440) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-(3-methylphenoxy)-N-(4-phenoxyphenyl)propanamide.
| Compound Name | 2-(3-methylphenoxy)-N-(4-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 3937440 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-(3-methylphenoxy)-N-(4-phenoxyphenyl)propanamide |
| SMILES | Cc1cccc(OC(C)C(=O)Nc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C22H21NO3/c1-16-7-6-10-21(15-16)25-17(2)22(24)23-18-11-13-20(14-12-18)26-19-8-4-3-5-9-19/h3-15,17H,1-2H3,(H,23,24) |
| InChIKey | SFYDTBZIKFEEQV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |