C11H14N2O3S — CID 137262068
(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butan-1-ol (PubChem CID 137262068) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butan-1-ol.
| Compound Name | (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butan-1-ol |
|---|---|
| PubChem CID | 137262068 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butan-1-ol |
| SMILES | CC[C@H](CO)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C11H14N2O3S/c1-2-8(7-14)12-11-9-5-3-4-6-10(9)17(15,16)13-11/h3-6,8,14H,2,7H2,1H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | WYQBVPFBYOXDRS-MRVPVSSYSA-N |
| XLogP | 0.50 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|