C17H23NO — CID 55171616
2-cyclopropyl-6,6-dimethyl-2,3,4,4a,5,10b-hexahydrobenzo[h][1,4]benzoxazine (PubChem CID 55171616) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-cyclopropyl-6,6-dimethyl-2,3,4,4a,5,10b-hexahydrobenzo[h][1,4]benzoxazine.
| Compound Name | 2-cyclopropyl-6,6-dimethyl-2,3,4,4a,5,10b-hexahydrobenzo[h][1,4]benzoxazine |
|---|---|
| PubChem CID | 55171616 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 2-cyclopropyl-6,6-dimethyl-2,3,4,4a,5,10b-hexahydrobenzo[h][1,4]benzoxazine |
| SMILES | CC1(C)CC2NCC(C3CC3)OC2c2ccccc21 |
| InChI | InChI=1S/C17H23NO/c1-17(2)9-14-16(12-5-3-4-6-13(12)17)19-15(10-18-14)11-7-8-11/h3-6,11,14-16,18H,7-10H2,1-2H3 |
| InChIKey | JILNLPVQZIMHER-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |